Home|About Us|Download|FAQ|Hot Products

I01-7419 2-[(4-amino-3-methylphenyl)-ethylamino]ethanol; sulfuric acid (CAS# 25646-77-9)

2-[(4-amino-3-methylphenyl)-ethylamino]ethanol; sulfuric acid 25646-77-9

General Information
Catalog No.:	I01-7419
Synonym:
Cas#:	25646-77-9
MDL# :	null
Molecular Formula:	C11H18N2O.H2O4S
Mole Weight:	292.11

Useful Links

Certificate of Analysis

Inquiry Online

Salutation:

Country:

Customer:

Company:

Email:

Requested quantity:

Remarks:

Reference info	Ref#	Purity/Analysis Method	Availability	Update At
	2012408790	99 /Others		2012-04-06 15:32

Related products

I01-7419

2-[(4-amino-3-methylphenyl)-ethylamino]ethanol; sulfuric acid

I01-3524

2-((4-amino-3-methylphenyl)ethylamino)ethyl sulfate

I01-2630

n,n-bis(2-hydroxyethyl)-p-phenylenediamine sulphate

I09-0499

2, 6-Bis (2-hydroxyethylamino) toluene sulfate

I14-6487

2-[2-(4-aminophenyl)ethylamino]ethanol; sulfuric acid

I01-1040

Sotalol hydrochloride

Related pages:

Search 2-[(4-amino-3-methylphenyl)-ethylamino]ethanol; sulfuric acid in google

Search in google

Search Cas in google

Search Formula C11H18N2O.H2O4S in google

CCN(CCO)c1ccc(N)c(C)c1.O[S](O)(=O)=O
  Mrv0541 04281314512D

19 18  0  0  0  0            999 V2000
    0.0000   -0.8250    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    0.0000    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    0.8250    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.8250   -0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8250    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.2077   -1.7973    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9222   -1.3848    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9222   -0.5598    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.6366   -0.1473    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3511   -0.5598    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0656   -0.1473    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.2077   -0.1473    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4932   -0.5598    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7788   -0.1473    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7788    0.6777    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0643    1.0902    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.4932    1.0902    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4932    1.9152    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2077    0.6777    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0  0  0  0
  2  3  1  0  0  0  0
  2  4  2  0  0  0  0
  2  5  2  0  0  0  0
  6  7  1  0  0  0  0
  7  8  1  0  0  0  0
  8  9  1  0  0  0  0
  9 10  1  0  0  0  0
 10 11  1  0  0  0  0
  8 12  1  0  0  0  0
 12 13  2  0  0  0  0
 13 14  1  0  0  0  0
 14 15  2  0  0  0  0
 15 16  1  0  0  0  0
 15 17  1  0  0  0  0
 17 18  1  0  0  0  0
 17 19  2  0  0  0  0
 12 19  1  0  0  0  0
M  END

Privacy |Terms and ConditionsCopyrights © 2010 IS Chemical Technology Ltd. All Rights Reserved.

沪ICP备09033181号